C15H21F2N3O2 — CID 174626919
[4-(4-amino-2,6-difluorophenyl)piperazin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174626919) has the molecular formula C15H21F2N3O2 and a molecular weight of 313.35 g/mol. Its IUPAC name is [4-(4-amino-2,6-difluorophenyl)piperazin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-(4-amino-2,6-difluorophenyl)piperazin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174626919 |
| Molecular Formula | C15H21F2N3O2 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | [4-(4-amino-2,6-difluorophenyl)piperazin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON1CCN(c2c(F)cc(N)cc2F)CC1 |
| InChI | InChI=1S/C15H21F2N3O2/c1-15(2,3)14(21)22-20-6-4-19(5-7-20)13-11(16)8-10(18)9-12(13)17/h8-9H,4-7,18H2,1-3H3 |
| InChIKey | BJDVZEWTFQJAPP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|