C23H30F6N4O2 — CID 91195120
2-[4-[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexyl]propanediamide (PubChem CID 91195120) has the molecular formula C23H30F6N4O2 and a molecular weight of 508.51 g/mol. Its IUPAC name is 2-[4-[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexyl]propanediamide.
| Compound Name | 2-[4-[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexyl]propanediamide |
|---|---|
| PubChem CID | 91195120 |
| Molecular Formula | C23H30F6N4O2 |
| Molecular Weight | 508.51 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | 2-[4-[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexyl]propanediamide |
| SMILES | NC(=O)C(C(N)=O)C1CCC(CCN2CCN(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C23H30F6N4O2/c24-22(25,26)16-11-17(23(27,28)29)13-18(12-16)33-9-7-32(8-10-33)6-5-14-1-3-15(4-2-14)19(20(30)34)21(31)35/h11-15,19H,1-10H2,(H2,30,34)(H2,31,35) |
| InChIKey | JIWMEWKBKHXNQQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|