C29H36N2O4S — CID 70675575
N-[4-[2-[4-(1-benzofuran-3-yl)piperidin-1-yl]ethyl]cyclohexyl]-4-methylsulfonylbenzamide (PubChem CID 70675575) has the molecular formula C29H36N2O4S and a molecular weight of 508.68 g/mol. Its IUPAC name is N-[4-[2-[4-(1-benzofuran-3-yl)piperidin-1-yl]ethyl]cyclohexyl]-4-methylsulfonylbenzamide.
| Compound Name | N-[4-[2-[4-(1-benzofuran-3-yl)piperidin-1-yl]ethyl]cyclohexyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 70675575 |
| Molecular Formula | C29H36N2O4S |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | N-[4-[2-[4-(1-benzofuran-3-yl)piperidin-1-yl]ethyl]cyclohexyl]-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)NC2CCC(CCN3CCC(c4coc5ccccc45)CC3)CC2)cc1 |
| InChI | InChI=1S/C29H36N2O4S/c1-36(33,34)25-12-8-23(9-13-25)29(32)30-24-10-6-21(7-11-24)14-17-31-18-15-22(16-19-31)27-20-35-28-5-3-2-4-26(27)28/h2-5,8-9,12-13,20-22,24H,6-7,10-11,14-19H2,1H3,(H,30,32) |
| InChIKey | BKGCONUTJMJLTI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |