C26H36N2O3 — CID 70675532
N-[4-[2-[4-(1-benzofuran-3-yl)piperidin-1-yl]ethyl]cyclohexyl]-2-(oxetan-3-yl)acetamide (PubChem CID 70675532) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is N-[4-[2-[4-(1-benzofuran-3-yl)piperidin-1-yl]ethyl]cyclohexyl]-2-(oxetan-3-yl)acetamide.
| Compound Name | N-[4-[2-[4-(1-benzofuran-3-yl)piperidin-1-yl]ethyl]cyclohexyl]-2-(oxetan-3-yl)acetamide |
|---|---|
| PubChem CID | 70675532 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | N-[4-[2-[4-(1-benzofuran-3-yl)piperidin-1-yl]ethyl]cyclohexyl]-2-(oxetan-3-yl)acetamide |
| SMILES | O=C(CC1COC1)NC1CCC(CCN2CCC(c3coc4ccccc34)CC2)CC1 |
| InChI | InChI=1S/C26H36N2O3/c29-26(15-20-16-30-17-20)27-22-7-5-19(6-8-22)9-12-28-13-10-21(11-14-28)24-18-31-25-4-2-1-3-23(24)25/h1-4,18-22H,5-17H2,(H,27,29) |
| InChIKey | HOMQYYYMDXLYHT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |