C12H17FN2O — CID 123929687
1-[4-(5-fluorohexa-1,3,5-trien-3-yl)piperazin-1-yl]ethanone (PubChem CID 123929687) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is 1-[4-(5-fluorohexa-1,3,5-trien-3-yl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(5-fluorohexa-1,3,5-trien-3-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 123929687 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1-[4-(5-fluorohexa-1,3,5-trien-3-yl)piperazin-1-yl]ethanone |
| SMILES | C=CC(=CC(=C)F)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C12H17FN2O/c1-4-12(9-10(2)13)15-7-5-14(6-8-15)11(3)16/h4,9H,1-2,5-8H2,3H3 |
| InChIKey | JIEQHOSRKBKFSY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|