C12H24B2O2 — CID 123930246
4,5,5-trimethyl-2-(4,5,5-trimethyloxaborolan-2-yl)oxaborolane (PubChem CID 123930246) has the molecular formula C12H24B2O2 and a molecular weight of 221.95 g/mol. Its IUPAC name is 4,5,5-trimethyl-2-(4,5,5-trimethyloxaborolan-2-yl)oxaborolane.
| Compound Name | 4,5,5-trimethyl-2-(4,5,5-trimethyloxaborolan-2-yl)oxaborolane |
|---|---|
| PubChem CID | 123930246 |
| Molecular Formula | C12H24B2O2 |
| Molecular Weight | 221.95 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 4,5,5-trimethyl-2-(4,5,5-trimethyloxaborolan-2-yl)oxaborolane |
| SMILES | CC1CB(B2CC(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C12H24B2O2/c1-9-7-13(15-11(9,3)4)14-8-10(2)12(5,6)16-14/h9-10H,7-8H2,1-6H3 |
| InChIKey | XCQGYOGOPZHSJF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.95 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|