C9H15BO3 — CID 102278370
3,5,7-trimethyl-2,8,9-trioxa-1-boratricyclo[3.3.1.13,7]decane (PubChem CID 102278370) has the molecular formula C9H15BO3 and a molecular weight of 182.03 g/mol. Its IUPAC name is 3,5,7-trimethyl-2,8,9-trioxa-1-boratricyclo[3.3.1.13,7]decane.
| Compound Name | 3,5,7-trimethyl-2,8,9-trioxa-1-boratricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 102278370 |
| Molecular Formula | C9H15BO3 |
| Molecular Weight | 182.03 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 3,5,7-trimethyl-2,8,9-trioxa-1-boratricyclo[3.3.1.13,7]decane |
| SMILES | CC12CC3(C)CC(C)(C1)OB(O2)O3 |
| InChI | InChI=1S/C9H15BO3/c1-7-4-8(2)6-9(3,5-7)13-10(11-7)12-8/h4-6H2,1-3H3 |
| InChIKey | UZIAIOHJKNTFFC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.03 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|