C10H20B2O4 — CID 22737490
2-(4,4-dimethyl-1,3,2-dioxaborinan-2-yl)-4,4-dimethyl-1,3,2-dioxaborinane (PubChem CID 22737490) has the molecular formula C10H20B2O4 and a molecular weight of 225.89 g/mol. Its IUPAC name is 2-(4,4-dimethyl-1,3,2-dioxaborinan-2-yl)-4,4-dimethyl-1,3,2-dioxaborinane.
| Compound Name | 2-(4,4-dimethyl-1,3,2-dioxaborinan-2-yl)-4,4-dimethyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 22737490 |
| Molecular Formula | C10H20B2O4 |
| Molecular Weight | 225.89 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 2-(4,4-dimethyl-1,3,2-dioxaborinan-2-yl)-4,4-dimethyl-1,3,2-dioxaborinane |
| SMILES | CC1(C)CCOB(B2OCCC(C)(C)O2)O1 |
| InChI | InChI=1S/C10H20B2O4/c1-9(2)5-7-13-11(15-9)12-14-8-6-10(3,4)16-12/h5-8H2,1-4H3 |
| InChIKey | JPIMOMPPMXVJMJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.89 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|