C11H21BO4 — CID 174086721
4,4-dimethyl-2-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)-1,3,2-dioxaborolane (PubChem CID 174086721) has the molecular formula C11H21BO4 and a molecular weight of 228.10 g/mol. Its IUPAC name is 4,4-dimethyl-2-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)-1,3,2-dioxaborolane.
| Compound Name | 4,4-dimethyl-2-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 174086721 |
| Molecular Formula | C11H21BO4 |
| Molecular Weight | 228.10 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 4,4-dimethyl-2-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)-1,3,2-dioxaborolane |
| SMILES | CC1(C)COB(C2OC(C)(C)C(C)(C)O2)O1 |
| InChI | InChI=1S/C11H21BO4/c1-9(2)7-13-12(16-9)8-14-10(3,4)11(5,6)15-8/h8H,7H2,1-6H3 |
| InChIKey | HSNPSYQDMDPDLA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.10 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|