C6H15NO2 — CID 174358085
azane;3,3-dimethyldioxane (PubChem CID 174358085) has the molecular formula C6H15NO2 and a molecular weight of 133.19 g/mol. Its IUPAC name is azane;3,3-dimethyldioxane.
| Compound Name | azane;3,3-dimethyldioxane |
|---|---|
| PubChem CID | 174358085 |
| Molecular Formula | C6H15NO2 |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.11 |
| IUPAC Name | azane;3,3-dimethyldioxane |
| SMILES | CC1(C)CCCOO1.N |
| InChI | InChI=1S/C6H12O2.H3N/c1-6(2)4-3-5-7-8-6;/h3-5H2,1-2H3;1H3 |
| InChIKey | MTBTYRLFKULAHX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 53.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|