About (2R)-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-dioxane]-3-one
(2R)-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-dioxane]-3-one (PubChem CID 135069914) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is (2R)-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-dioxane]-3-one.
Molecular Properties
| Compound Name | (2R)-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-dioxane]-3-one |
| PubChem CID | 135069914 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (2R)-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-dioxane]-3-one |
| SMILES | CC1(C)C2CC(=O)[C@@]3(CCCOO3)C1C2 |
| InChI | InChI=1S/C12H18O3/c1-11(2)8-6-9(11)12(10(13)7-8)4-3-5-14-15-12/h8-9H,3-7H2,1-2H3/t8?,9?,12-/m1/s1 |
| InChIKey | UQYAYYJKFJQKRB-SHVIVCPWSA-N |
| XLogP | 2.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (2R)-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-dioxane]-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-dioxane]-3-one?
The IUPAC name of (2R)-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-dioxane]-3-one (CID 135069914) is (2R)-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-dioxane]-3-one.
What is the SMILES notation for (2R)-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-dioxane]-3-one?
The canonical SMILES for (2R)-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-dioxane]-3-one is CC1(C)C2CC(=O)[C@@]3(CCCOO3)C1C2.
What is the InChIKey of (2R)-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-dioxane]-3-one?
The InChIKey is UQYAYYJKFJQKRB-SHVIVCPWSA-N. The full InChI is InChI=1S/C12H18O3/c1-11(2)8-6-9(11)12(10(13)7-8)4-3-5-14-15-12/h8-9H,3-7H2,1-2H3/t8?,9?,12-/m1/s1.
What are the key properties of (2R)-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-dioxane]-3-one?
(2R)-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-dioxane]-3-one has a molecular weight of 210.27 g/mol, XLogP of 2.10, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-dioxane]-3-one is sourced from PubChem (CID 135069914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).