C21H42B3N3O6 — CID 154717021
1,3,5-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,5-triazinane (PubChem CID 154717021) has the molecular formula C21H42B3N3O6 and a molecular weight of 465.02 g/mol. Its IUPAC name is 1,3,5-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,5-triazinane.
| Compound Name | 1,3,5-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,5-triazinane |
|---|---|
| PubChem CID | 154717021 |
| Molecular Formula | C21H42B3N3O6 |
| Molecular Weight | 465.02 g/mol |
| Exact Mass | 465.34 |
| IUPAC Name | 1,3,5-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,5-triazinane |
| SMILES | CC1(C)OB(N2CN(B3OC(C)(C)C(C)(C)O3)CN(B3OC(C)(C)C(C)(C)O3)C2)OC1(C)C |
| InChI | InChI=1S/C21H42B3N3O6/c1-16(2)17(3,4)29-22(28-16)25-13-26(23-30-18(5,6)19(7,8)31-23)15-27(14-25)24-32-20(9,10)21(11,12)33-24/h13-15H2,1-12H3 |
| InChIKey | TWNRKDOFYPPFIU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.02 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|