C14H26BNO2Sn — CID 78224417
trimethyl-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyridin-4-yl]stannane (PubChem CID 78224417) has the molecular formula C14H26BNO2Sn and a molecular weight of 369.89 g/mol. Its IUPAC name is trimethyl-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyridin-4-yl]stannane.
| Compound Name | trimethyl-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyridin-4-yl]stannane |
|---|---|
| PubChem CID | 78224417 |
| Molecular Formula | C14H26BNO2Sn |
| Molecular Weight | 369.89 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | trimethyl-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyridin-4-yl]stannane |
| SMILES | CC1(C)OB(N2C=CC([Sn](C)(C)C)=CC2)OC1(C)C |
| InChI | InChI=1S/C11H17BNO2.3CH3.Sn/c1-10(2)11(3,4)15-12(14-10)13-8-6-5-7-9-13;;;;/h6-8H,9H2,1-4H3;3*1H3; |
| InChIKey | WEVUVXHCTQIPKB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.89 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|