C22H32B2Cl4N2O4 — CID 139125867
3,5-dichloro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4H-pyridine (PubChem CID 139125867) has the molecular formula C22H32B2Cl4N2O4 and a molecular weight of 551.94 g/mol. Its IUPAC name is 3,5-dichloro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4H-pyridine.
| Compound Name | 3,5-dichloro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4H-pyridine |
|---|---|
| PubChem CID | 139125867 |
| Molecular Formula | C22H32B2Cl4N2O4 |
| Molecular Weight | 551.94 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | 3,5-dichloro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4H-pyridine |
| SMILES | CC1(C)OB(N2C=C(Cl)CC(Cl)=C2)OC1(C)C.CC1(C)OB(N2C=C(Cl)CC(Cl)=C2)OC1(C)C |
| InChI | InChI=1S/2C11H16BCl2NO2/c2*1-10(2)11(3,4)17-12(16-10)15-6-8(13)5-9(14)7-15/h2*6-7H,5H2,1-4H3 |
| InChIKey | JWHSFVIOLIWXAK-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.94 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|