C12H23BN2O2 — CID 99868649
(1R,5R)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,8-diazabicyclo[3.2.1]octane (PubChem CID 99868649) has the molecular formula C12H23BN2O2 and a molecular weight of 238.14 g/mol. Its IUPAC name is (1R,5R)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | (1R,5R)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 99868649 |
| Molecular Formula | C12H23BN2O2 |
| Molecular Weight | 238.14 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (1R,5R)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CC1(C)OB(N2[C@@H]3CC[C@@H]2CNC3)OC1(C)C |
| InChI | InChI=1S/C12H23BN2O2/c1-11(2)12(3,4)17-13(16-11)15-9-5-6-10(15)8-14-7-9/h9-10,14H,5-8H2,1-4H3/t9-,10-/m1/s1 |
| InChIKey | RTYWTPOIGJMYEE-NXEZZACHSA-N |
| XLogP | 1.01 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.14 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|