C6H13N2P — CID 167294099
3,8-diazabicyclo[3.2.1]octan-8-ylphosphane (PubChem CID 167294099) has the molecular formula C6H13N2P and a molecular weight of 144.16 g/mol. Its IUPAC name is 3,8-diazabicyclo[3.2.1]octan-8-ylphosphane.
| Compound Name | 3,8-diazabicyclo[3.2.1]octan-8-ylphosphane |
|---|---|
| PubChem CID | 167294099 |
| Molecular Formula | C6H13N2P |
| Molecular Weight | 144.16 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 3,8-diazabicyclo[3.2.1]octan-8-ylphosphane |
| SMILES | PN1C2CCC1CNC2 |
| InChI | InChI=1S/C6H13N2P/c9-8-5-1-2-6(8)4-7-3-5/h5-7H,1-4,9H2 |
| InChIKey | WEJHVEQHTVTNCI-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.16 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|