C7H15N3 — CID 155383691
3,9-diazabicyclo[3.3.1]nonan-9-amine (PubChem CID 155383691) has the molecular formula C7H15N3 and a molecular weight of 141.22 g/mol. Its IUPAC name is 3,9-diazabicyclo[3.3.1]nonan-9-amine.
| Compound Name | 3,9-diazabicyclo[3.3.1]nonan-9-amine |
|---|---|
| PubChem CID | 155383691 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | 3,9-diazabicyclo[3.3.1]nonan-9-amine |
| SMILES | NN1C2CCCC1CNC2 |
| InChI | InChI=1S/C7H15N3/c8-10-6-2-1-3-7(10)5-9-4-6/h6-7,9H,1-5,8H2 |
| InChIKey | GKTOTTIJAGCFPF-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|