C10H21BN2O2 — CID 168837814
1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolidine (PubChem CID 168837814) has the molecular formula C10H21BN2O2 and a molecular weight of 212.10 g/mol. Its IUPAC name is 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolidine.
| Compound Name | 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolidine |
|---|---|
| PubChem CID | 168837814 |
| Molecular Formula | C10H21BN2O2 |
| Molecular Weight | 212.10 g/mol |
| Exact Mass | 212.17 |
| IUPAC Name | 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolidine |
| SMILES | CN1CC(B2OC(C)(C)C(C)(C)O2)CN1 |
| InChI | InChI=1S/C10H21BN2O2/c1-9(2)10(3,4)15-11(14-9)8-6-12-13(5)7-8/h8,12H,6-7H2,1-5H3 |
| InChIKey | OFIKIRRIJQXYMS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.10 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|