C13H25BNO2P — CID 142863391
[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]phosphane (PubChem CID 142863391) has the molecular formula C13H25BNO2P and a molecular weight of 269.13 g/mol. Its IUPAC name is [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]phosphane.
| Compound Name | [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]phosphane |
|---|---|
| PubChem CID | 142863391 |
| Molecular Formula | C13H25BNO2P |
| Molecular Weight | 269.13 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]phosphane |
| SMILES | CC1(C)OB(C2CC3CN(P)CC3C2)OC1(C)C |
| InChI | InChI=1S/C13H25BNO2P/c1-12(2)13(3,4)17-14(16-12)11-5-9-7-15(18)8-10(9)6-11/h9-11H,5-8,18H2,1-4H3 |
| InChIKey | OGZCQWMWGZBPAL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.13 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|