C12H20BN2O4+ — CID 73257645
1,3-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5H-pyrimidin-1-ium-2,4-dione (PubChem CID 73257645) has the molecular formula C12H20BN2O4+ and a molecular weight of 267.11 g/mol. Its IUPAC name is 1,3-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5H-pyrimidin-1-ium-2,4-dione.
| Compound Name | 1,3-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5H-pyrimidin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 73257645 |
| Molecular Formula | C12H20BN2O4+ |
| Molecular Weight | 267.11 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 1,3-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5H-pyrimidin-1-ium-2,4-dione |
| SMILES | CN1C(=O)C(B2OC(C)(C)C(C)(C)O2)C=[N+](C)C1=O |
| InChI | InChI=1S/C12H20BN2O4/c1-11(2)12(3,4)19-13(18-11)8-7-14(5)10(17)15(6)9(8)16/h7-8H,1-6H3/q+1 |
| InChIKey | VIZOWTJMGZKEIM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.11 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|