C16H21N2O5S+ — CID 78459643
(5-methyl-2-propan-2-ylphenyl) 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-sulfonate (PubChem CID 78459643) has the molecular formula C16H21N2O5S+ and a molecular weight of 353.42 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylphenyl) 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-sulfonate.
| Compound Name | (5-methyl-2-propan-2-ylphenyl) 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-sulfonate |
|---|---|
| PubChem CID | 78459643 |
| Molecular Formula | C16H21N2O5S+ |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (5-methyl-2-propan-2-ylphenyl) 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-sulfonate |
| SMILES | Cc1ccc(C(C)C)c(OS(=O)(=O)C2C=[N+](C)C(=O)N(C)C2=O)c1 |
| InChI | InChI=1S/C16H21N2O5S/c1-10(2)12-7-6-11(3)8-13(12)23-24(21,22)14-9-17(4)16(20)18(5)15(14)19/h6-10,14H,1-5H3/q+1 |
| InChIKey | RKNSGWICESLGKX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|