C15H18BNO3 — CID 171035254
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5H-isoquinolin-1-one (PubChem CID 171035254) has the molecular formula C15H18BNO3 and a molecular weight of 271.12 g/mol. Its IUPAC name is 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5H-isoquinolin-1-one.
| Compound Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5H-isoquinolin-1-one |
|---|---|
| PubChem CID | 171035254 |
| Molecular Formula | C15H18BNO3 |
| Molecular Weight | 271.12 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5H-isoquinolin-1-one |
| SMILES | CC1(C)OB(C2C=CC=C3C(=O)N=CC=C32)OC1(C)C |
| InChI | InChI=1S/C15H18BNO3/c1-14(2)15(3,4)20-16(19-14)12-7-5-6-11-10(12)8-9-17-13(11)18/h5-9,12H,1-4H3 |
| InChIKey | FUFZMZMUHLCBKC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.12 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|