C18H21BN2O3 — CID 163777197
2-pyridin-3-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7,7a-dihydro-1,3-benzoxazole (PubChem CID 163777197) has the molecular formula C18H21BN2O3 and a molecular weight of 324.19 g/mol. Its IUPAC name is 2-pyridin-3-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7,7a-dihydro-1,3-benzoxazole.
| Compound Name | 2-pyridin-3-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7,7a-dihydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 163777197 |
| Molecular Formula | C18H21BN2O3 |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-pyridin-3-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7,7a-dihydro-1,3-benzoxazole |
| SMILES | CC1(C)OB(C2C=CC=C3N=C(c4cccnc4)OC32)OC1(C)C |
| InChI | InChI=1S/C18H21BN2O3/c1-17(2)18(3,4)24-19(23-17)13-8-5-9-14-15(13)22-16(21-14)12-7-6-10-20-11-12/h5-11,13,15H,1-4H3 |
| InChIKey | MLMUKVONVKKEOA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 52.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|