C15H20BNO3 — CID 89445245
1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydroquinolin-2-one (PubChem CID 89445245) has the molecular formula C15H20BNO3 and a molecular weight of 273.14 g/mol. Its IUPAC name is 1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydroquinolin-2-one.
| Compound Name | 1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 89445245 |
| Molecular Formula | C15H20BNO3 |
| Molecular Weight | 273.14 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydroquinolin-2-one |
| SMILES | CC1(C)OB(N2C(=O)CCc3ccccc32)OC1(C)C |
| InChI | InChI=1S/C15H20BNO3/c1-14(2)15(3,4)20-16(19-14)17-12-8-6-5-7-11(12)9-10-13(17)18/h5-8H,9-10H2,1-4H3 |
| InChIKey | RWTMMBVWFOQNCH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.14 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|