C19H27BFNO2 — CID 171110131
1-[4-fluoro-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-yl]-2,3-dihydroindole (PubChem CID 171110131) has the molecular formula C19H27BFNO2 and a molecular weight of 331.24 g/mol. Its IUPAC name is 1-[4-fluoro-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-yl]-2,3-dihydroindole.
| Compound Name | 1-[4-fluoro-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-yl]-2,3-dihydroindole |
|---|---|
| PubChem CID | 171110131 |
| Molecular Formula | C19H27BFNO2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 1-[4-fluoro-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-yl]-2,3-dihydroindole |
| SMILES | CC(C)(C=C(F)B1OC(C)(C)C(C)(C)O1)N1CCc2ccccc21 |
| InChI | InChI=1S/C19H27BFNO2/c1-17(2,22-12-11-14-9-7-8-10-15(14)22)13-16(21)20-23-18(3,4)19(5,6)24-20/h7-10,13H,11-12H2,1-6H3 |
| InChIKey | LZYMEOPSRNPYIP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|