C16H28BFO3 — CID 171110458
2-[1-fluoro-3-methyl-3-(oxan-4-yl)but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171110458) has the molecular formula C16H28BFO3 and a molecular weight of 298.21 g/mol. Its IUPAC name is 2-[1-fluoro-3-methyl-3-(oxan-4-yl)but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[1-fluoro-3-methyl-3-(oxan-4-yl)but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171110458 |
| Molecular Formula | C16H28BFO3 |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 2-[1-fluoro-3-methyl-3-(oxan-4-yl)but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)(C=C(F)B1OC(C)(C)C(C)(C)O1)C1CCOCC1 |
| InChI | InChI=1S/C16H28BFO3/c1-14(2,12-7-9-19-10-8-12)11-13(18)17-20-15(3,4)16(5,6)21-17/h11-12H,7-10H2,1-6H3 |
| InChIKey | JQWCGLRPPVZRNE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|