C18H30BFO3 — CID 171114219
2-[fluoro-[4-(oxolan-3-ylmethyl)cyclohexylidene]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171114219) has the molecular formula C18H30BFO3 and a molecular weight of 324.25 g/mol. Its IUPAC name is 2-[fluoro-[4-(oxolan-3-ylmethyl)cyclohexylidene]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[fluoro-[4-(oxolan-3-ylmethyl)cyclohexylidene]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171114219 |
| Molecular Formula | C18H30BFO3 |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 2-[fluoro-[4-(oxolan-3-ylmethyl)cyclohexylidene]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(F)=C2CCC(CC3CCOC3)CC2)OC1(C)C |
| InChI | InChI=1S/C18H30BFO3/c1-17(2)18(3,4)23-19(22-17)16(20)15-7-5-13(6-8-15)11-14-9-10-21-12-14/h13-14H,5-12H2,1-4H3/b16-15- |
| InChIKey | ARUQINVBYQILHT-NXVVXOECSA-N |
| XLogP | 4.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|