C33H37F3N3O4Si+ — CID 123931000
methyl 3-[4-[5-[5-(cyclohexatrienyl)-4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate (PubChem CID 123931000) has the molecular formula C33H37F3N3O4Si+ and a molecular weight of 624.76 g/mol. Its IUPAC name is methyl 3-[4-[5-[5-(cyclohexatrienyl)-4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[4-[5-[5-(cyclohexatrienyl)-4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 123931000 |
| Molecular Formula | C33H37F3N3O4Si+ |
| Molecular Weight | 624.76 g/mol |
| Exact Mass | 624.25 |
| IUPAC Name | methyl 3-[4-[5-[5-(cyclohexatrienyl)-4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)COc1ccc(-c2ccc(-c3nc(C(F)(F)F)c(C4=CC=[C+]C=C4)n3COCC[Si](C)(C)C)cn2)cc1 |
| InChI | InChI=1S/C33H37F3N3O4Si/c1-32(2,31(40)41-3)21-43-26-15-12-23(13-16-26)27-17-14-25(20-37-27)30-38-29(33(34,35)36)28(24-10-8-7-9-11-24)39(30)22-42-18-19-44(4,5)6/h8-17,20H,18-19,21-22H2,1-6H3/q+1 |
| InChIKey | QWALKVKHSRHEKA-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.76 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|