C54H45Cl6N6+3 — CID 123931838
1-[[3,5-bis[[4,5-dichloro-3-(2-naphthalen-1-ylethyl)imidazol-1-ium-1-yl]methyl]phenyl]methyl]-4,5-dichloro-3-(2-naphthalen-1-ylethyl)imidazol-1-ium (PubChem CID 123931838) has the molecular formula C54H45Cl6N6+3 and a molecular weight of 990.71 g/mol. Its IUPAC name is 1-[[3,5-bis[[4,5-dichloro-3-(2-naphthalen-1-ylethyl)imidazol-1-ium-1-yl]methyl]phenyl]methyl]-4,5-dichloro-3-(2-naphthalen-1-ylethyl)imidazol-1-ium.
| Compound Name | 1-[[3,5-bis[[4,5-dichloro-3-(2-naphthalen-1-ylethyl)imidazol-1-ium-1-yl]methyl]phenyl]methyl]-4,5-dichloro-3-(2-naphthalen-1-ylethyl)imidazol-1-ium |
|---|---|
| PubChem CID | 123931838 |
| Molecular Formula | C54H45Cl6N6+3 |
| Molecular Weight | 990.71 g/mol |
| Exact Mass | 987.18 |
| IUPAC Name | 1-[[3,5-bis[[4,5-dichloro-3-(2-naphthalen-1-ylethyl)imidazol-1-ium-1-yl]methyl]phenyl]methyl]-4,5-dichloro-3-(2-naphthalen-1-ylethyl)imidazol-1-ium |
| SMILES | Clc1c(Cl)[n+](Cc2cc(C[n+]3cn(CCc4cccc5ccccc45)c(Cl)c3Cl)cc(C[n+]3cn(CCc4cccc5ccccc45)c(Cl)c3Cl)c2)cn1CCc1cccc2ccccc12 |
| InChI | InChI=1S/C54H45Cl6N6/c55-49-52(58)64(34-61(49)25-22-43-16-7-13-40-10-1-4-19-46(40)43)31-37-28-38(32-65-35-62(50(56)53(65)59)26-23-44-17-8-14-41-11-2-5-20-47(41)44)30-39(29-37)33-66-36-63(51(57)54(66)60)27-24-45-18-9-15-42-12-3-6-21-48(42)45/h1-21,28-30,34-36H,22-27,31-33H2/q+3 |
| InChIKey | XMIQUZREODRONH-UHFFFAOYSA-N |
| XLogP | 13.21 |
| TPSA | 26.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 990.71 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|