C9H13N3 — CID 123932039
2-cyclohexa-2,4-dien-1-yl-1-ethylideneguanidine (PubChem CID 123932039) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-yl-1-ethylideneguanidine.
| Compound Name | 2-cyclohexa-2,4-dien-1-yl-1-ethylideneguanidine |
|---|---|
| PubChem CID | 123932039 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-yl-1-ethylideneguanidine |
| SMILES | CC=N/C(N)=N\C1C=CC=CC1 |
| InChI | InChI=1S/C9H13N3/c1-2-11-9(10)12-8-6-4-3-5-7-8/h2-6,8H,7H2,1H3,(H2,10,12) |
| InChIKey | QPNONAWSWKQMPB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|