C8H12N2 — CID 150911079
N'-cyclohexa-2,4-dien-1-ylethanimidamide (PubChem CID 150911079) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is N'-cyclohexa-2,4-dien-1-ylethanimidamide.
| Compound Name | N'-cyclohexa-2,4-dien-1-ylethanimidamide |
|---|---|
| PubChem CID | 150911079 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | N'-cyclohexa-2,4-dien-1-ylethanimidamide |
| SMILES | C/C(N)=N\C1C=CC=CC1 |
| InChI | InChI=1S/C8H12N2/c1-7(9)10-8-5-3-2-4-6-8/h2-5,8H,6H2,1H3,(H2,9,10) |
| InChIKey | LBZVNHQBCMQBEY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|