C14H24N2 — CID 143753026
(2E,6Z,8E)-N'-(2-methylpropyl)deca-2,6,8-trienimidamide (PubChem CID 143753026) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is (2E,6Z,8E)-N'-(2-methylpropyl)deca-2,6,8-trienimidamide.
| Compound Name | (2E,6Z,8E)-N'-(2-methylpropyl)deca-2,6,8-trienimidamide |
|---|---|
| PubChem CID | 143753026 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | (2E,6Z,8E)-N'-(2-methylpropyl)deca-2,6,8-trienimidamide |
| SMILES | C/C=C/C=C\CC/C=C/C(N)=N/CC(C)C |
| InChI | InChI=1S/C14H24N2/c1-4-5-6-7-8-9-10-11-14(15)16-12-13(2)3/h4-7,10-11,13H,8-9,12H2,1-3H3,(H2,15,16)/b5-4+,7-6-,11-10+ |
| InChIKey | YFBQXXALIXWMLK-HVWOQQCMSA-N |
| XLogP | 3.47 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|