About (2Z)-N',4-dimethylhexa-2,5-dienimidamide
(2Z)-N',4-dimethylhexa-2,5-dienimidamide (PubChem CID 123486543) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is (2Z)-N',4-dimethylhexa-2,5-dienimidamide.
Molecular Properties
| Compound Name | (2Z)-N',4-dimethylhexa-2,5-dienimidamide |
| PubChem CID | 123486543 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (2Z)-N',4-dimethylhexa-2,5-dienimidamide |
| SMILES | C=CC(C)/C=C\C(N)=N\C |
| InChI | InChI=1S/C8H14N2/c1-4-7(2)5-6-8(9)10-3/h4-7H,1H2,2-3H3,(H2,9,10)/b6-5- |
| InChIKey | ZGUUIXLYQMLQAW-WAYWQWQTSA-N |
| XLogP | 1.35 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-N',4-dimethylhexa-2,5-dienimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-N',4-dimethylhexa-2,5-dienimidamide?
The IUPAC name of (2Z)-N',4-dimethylhexa-2,5-dienimidamide (CID 123486543) is (2Z)-N',4-dimethylhexa-2,5-dienimidamide.
What is the SMILES notation for (2Z)-N',4-dimethylhexa-2,5-dienimidamide?
The canonical SMILES for (2Z)-N',4-dimethylhexa-2,5-dienimidamide is C=CC(C)/C=C\C(N)=N\C.
What is the InChIKey of (2Z)-N',4-dimethylhexa-2,5-dienimidamide?
The InChIKey is ZGUUIXLYQMLQAW-WAYWQWQTSA-N. The full InChI is InChI=1S/C8H14N2/c1-4-7(2)5-6-8(9)10-3/h4-7H,1H2,2-3H3,(H2,9,10)/b6-5-.
What are the key properties of (2Z)-N',4-dimethylhexa-2,5-dienimidamide?
(2Z)-N',4-dimethylhexa-2,5-dienimidamide has a molecular weight of 138.21 g/mol, XLogP of 1.35, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-N',4-dimethylhexa-2,5-dienimidamide is sourced from PubChem (CID 123486543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).