About (Z)-N'-ethyl-4-methyl-N-methylidenepent-2-enimidamide
(Z)-N'-ethyl-4-methyl-N-methylidenepent-2-enimidamide (PubChem CID 123530774) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is (Z)-N'-ethyl-4-methyl-N-methylidenepent-2-enimidamide.
Molecular Properties
| Compound Name | (Z)-N'-ethyl-4-methyl-N-methylidenepent-2-enimidamide |
| PubChem CID | 123530774 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (Z)-N'-ethyl-4-methyl-N-methylidenepent-2-enimidamide |
| SMILES | C=NC(/C=C\C(C)C)=N\CC |
| InChI | InChI=1S/C9H16N2/c1-5-11-9(10-4)7-6-8(2)3/h6-8H,4-5H2,1-3H3/b7-6-,11-9- |
| InChIKey | YJMBSQXWDZFDLW-XEZITKEBSA-N |
| XLogP | 2.32 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N'-ethyl-4-methyl-N-methylidenepent-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N'-ethyl-4-methyl-N-methylidenepent-2-enimidamide?
The IUPAC name of (Z)-N'-ethyl-4-methyl-N-methylidenepent-2-enimidamide (CID 123530774) is (Z)-N'-ethyl-4-methyl-N-methylidenepent-2-enimidamide.
What is the SMILES notation for (Z)-N'-ethyl-4-methyl-N-methylidenepent-2-enimidamide?
The canonical SMILES for (Z)-N'-ethyl-4-methyl-N-methylidenepent-2-enimidamide is C=NC(/C=C\C(C)C)=N\CC.
What is the InChIKey of (Z)-N'-ethyl-4-methyl-N-methylidenepent-2-enimidamide?
The InChIKey is YJMBSQXWDZFDLW-XEZITKEBSA-N. The full InChI is InChI=1S/C9H16N2/c1-5-11-9(10-4)7-6-8(2)3/h6-8H,4-5H2,1-3H3/b7-6-,11-9-.
What are the key properties of (Z)-N'-ethyl-4-methyl-N-methylidenepent-2-enimidamide?
(Z)-N'-ethyl-4-methyl-N-methylidenepent-2-enimidamide has a molecular weight of 152.24 g/mol, XLogP of 2.32, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N'-ethyl-4-methyl-N-methylidenepent-2-enimidamide is sourced from PubChem (CID 123530774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).