C15H24N2 — CID 138483254
N'-[(2E,4Z)-4-ethyl-8-methylnona-2,4,7-trienyl]-N-methylideneethanimidamide (PubChem CID 138483254) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is N'-[(2E,4Z)-4-ethyl-8-methylnona-2,4,7-trienyl]-N-methylideneethanimidamide.
| Compound Name | N'-[(2E,4Z)-4-ethyl-8-methylnona-2,4,7-trienyl]-N-methylideneethanimidamide |
|---|---|
| PubChem CID | 138483254 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | N'-[(2E,4Z)-4-ethyl-8-methylnona-2,4,7-trienyl]-N-methylideneethanimidamide |
| SMILES | C=N/C(C)=N/C/C=C/C(=C\CC=C(C)C)CC |
| InChI | InChI=1S/C15H24N2/c1-6-15(10-7-9-13(2)3)11-8-12-17-14(4)16-5/h8-11H,5-7,12H2,1-4H3/b11-8+,15-10-,17-14+ |
| InChIKey | LNNNBDYWKXRJQC-MJWWHBMWSA-N |
| XLogP | 4.35 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|