C9H10N2OS — CID 123932195
3-(5-ethyl-1,3-thiazol-2-yl)-5-methyl-1,2-oxazole (PubChem CID 123932195) has the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. Its IUPAC name is 3-(5-ethyl-1,3-thiazol-2-yl)-5-methyl-1,2-oxazole.
| Compound Name | 3-(5-ethyl-1,3-thiazol-2-yl)-5-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 123932195 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 3-(5-ethyl-1,3-thiazol-2-yl)-5-methyl-1,2-oxazole |
| SMILES | CCc1cnc(-c2cc(C)on2)s1 |
| InChI | InChI=1S/C9H10N2OS/c1-3-7-5-10-9(13-7)8-4-6(2)12-11-8/h4-5H,3H2,1-2H3 |
| InChIKey | PEPDMHZQUQHRQN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |