C10H17N — CID 123933853
(7Z)-6-ethyl-5-methyl-3,4,5,6-tetrahydroazocine (PubChem CID 123933853) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (7Z)-6-ethyl-5-methyl-3,4,5,6-tetrahydroazocine.
| Compound Name | (7Z)-6-ethyl-5-methyl-3,4,5,6-tetrahydroazocine |
|---|---|
| PubChem CID | 123933853 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (7Z)-6-ethyl-5-methyl-3,4,5,6-tetrahydroazocine |
| SMILES | CCC1/C=C\N=C/CCC1C |
| InChI | InChI=1S/C10H17N/c1-3-10-6-8-11-7-4-5-9(10)2/h6-10H,3-5H2,1-2H3/b8-6-,11-7- |
| InChIKey | XFJNOWAZKJUBAG-NFNKYSHCSA-N |
| XLogP | 3.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |