C11H17N — CID 134861499
(4aR,10aS)-4a,5,6,7,8,9,10,10a-octahydrocycloocta[c]pyridine (PubChem CID 134861499) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (4aR,10aS)-4a,5,6,7,8,9,10,10a-octahydrocycloocta[c]pyridine.
| Compound Name | (4aR,10aS)-4a,5,6,7,8,9,10,10a-octahydrocycloocta[c]pyridine |
|---|---|
| PubChem CID | 134861499 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (4aR,10aS)-4a,5,6,7,8,9,10,10a-octahydrocycloocta[c]pyridine |
| SMILES | C1=C[C@H]2CCCCCC[C@@H]2C=N1 |
| InChI | InChI=1S/C11H17N/c1-2-4-6-11-9-12-8-7-10(11)5-3-1/h7-11H,1-6H2/t10-,11-/m1/s1 |
| InChIKey | NSOLPWDJUUXOLA-GHMZBOCLSA-N |
| XLogP | 3.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |