C10H15N — CID 57016506
3-cyclopentyl-3,4-dihydropyridine (PubChem CID 57016506) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 3-cyclopentyl-3,4-dihydropyridine.
| Compound Name | 3-cyclopentyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 57016506 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 3-cyclopentyl-3,4-dihydropyridine |
| SMILES | C1=CN=CC(C2CCCC2)C1 |
| InChI | InChI=1S/C10H15N/c1-2-5-9(4-1)10-6-3-7-11-8-10/h3,7-10H,1-2,4-6H2 |
| InChIKey | SXZHBFCHFUSRME-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |