C14H23N — CID 56982808
4-cyclooctyl-5-methyl-3,4-dihydropyridine (PubChem CID 56982808) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 4-cyclooctyl-5-methyl-3,4-dihydropyridine.
| Compound Name | 4-cyclooctyl-5-methyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 56982808 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 4-cyclooctyl-5-methyl-3,4-dihydropyridine |
| SMILES | CC1=CN=CCC1C1CCCCCCC1 |
| InChI | InChI=1S/C14H23N/c1-12-11-15-10-9-14(12)13-7-5-3-2-4-6-8-13/h10-11,13-14H,2-9H2,1H3 |
| InChIKey | MMCRYVWYHQEVCC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |