C12H19N — CID 57010115
4-cyclohexyl-5-methyl-3,4-dihydropyridine (PubChem CID 57010115) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 4-cyclohexyl-5-methyl-3,4-dihydropyridine.
| Compound Name | 4-cyclohexyl-5-methyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 57010115 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 4-cyclohexyl-5-methyl-3,4-dihydropyridine |
| SMILES | CC1=CN=CCC1C1CCCCC1 |
| InChI | InChI=1S/C12H19N/c1-10-9-13-8-7-12(10)11-5-3-2-4-6-11/h8-9,11-12H,2-7H2,1H3 |
| InChIKey | RPXOPMBPJAYKBL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |