C8H13N — CID 90809154
5-ethyl-4-methyl-3,4-dihydropyridine (PubChem CID 90809154) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is 5-ethyl-4-methyl-3,4-dihydropyridine.
| Compound Name | 5-ethyl-4-methyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 90809154 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 5-ethyl-4-methyl-3,4-dihydropyridine |
| SMILES | CCC1=CN=CCC1C |
| InChI | InChI=1S/C8H13N/c1-3-8-6-9-5-4-7(8)2/h5-7H,3-4H2,1-2H3 |
| InChIKey | AAMXZLUZYYBRNZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |