C8H12FN — CID 167009176
5-ethyl-4-fluoro-3-methyl-3,4-dihydropyridine (PubChem CID 167009176) has the molecular formula C8H12FN and a molecular weight of 141.19 g/mol. Its IUPAC name is 5-ethyl-4-fluoro-3-methyl-3,4-dihydropyridine.
| Compound Name | 5-ethyl-4-fluoro-3-methyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 167009176 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | 5-ethyl-4-fluoro-3-methyl-3,4-dihydropyridine |
| SMILES | CCC1=CN=CC(C)C1F |
| InChI | InChI=1S/C8H12FN/c1-3-7-5-10-4-6(2)8(7)9/h4-6,8H,3H2,1-2H3 |
| InChIKey | WSLOUMFRYLNMCQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |