About 2,4-dimethyl-5-(trifluoromethyl)-3,4-dihydropyridine
2,4-dimethyl-5-(trifluoromethyl)-3,4-dihydropyridine (PubChem CID 148775053) has the molecular formula C8H10F3N
and a molecular weight of 177.17 g/mol. Its IUPAC name is 2,4-dimethyl-5-(trifluoromethyl)-3,4-dihydropyridine.
Analyze 2,4-dimethyl-5-(trifluoromethyl)-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-5-(trifluoromethyl)-3,4-dihydropyridine?
The IUPAC name of 2,4-dimethyl-5-(trifluoromethyl)-3,4-dihydropyridine (CID 148775053) is 2,4-dimethyl-5-(trifluoromethyl)-3,4-dihydropyridine.
What is the SMILES notation for 2,4-dimethyl-5-(trifluoromethyl)-3,4-dihydropyridine?
The canonical SMILES for 2,4-dimethyl-5-(trifluoromethyl)-3,4-dihydropyridine is CC1=NC=C(C(F)(F)F)C(C)C1.
What is the InChIKey of 2,4-dimethyl-5-(trifluoromethyl)-3,4-dihydropyridine?
The InChIKey is OJEKEKPUYYCVBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3N/c1-5-3-6(2)12-4-7(5)8(9,10)11/h4-5H,3H2,1-2H3.
What are the key properties of 2,4-dimethyl-5-(trifluoromethyl)-3,4-dihydropyridine?
2,4-dimethyl-5-(trifluoromethyl)-3,4-dihydropyridine has a molecular weight of 177.17 g/mol, XLogP of 2.93, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-5-(trifluoromethyl)-3,4-dihydropyridine is sourced from PubChem (CID 148775053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).