About 2-propan-2-yl-5-(trifluoromethyl)-3,4-dihydropyridine
2-propan-2-yl-5-(trifluoromethyl)-3,4-dihydropyridine (PubChem CID 145484033) has the molecular formula C9H12F3N
and a molecular weight of 191.20 g/mol. Its IUPAC name is 2-propan-2-yl-5-(trifluoromethyl)-3,4-dihydropyridine.
Analyze 2-propan-2-yl-5-(trifluoromethyl)-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-5-(trifluoromethyl)-3,4-dihydropyridine?
The IUPAC name of 2-propan-2-yl-5-(trifluoromethyl)-3,4-dihydropyridine (CID 145484033) is 2-propan-2-yl-5-(trifluoromethyl)-3,4-dihydropyridine.
What is the SMILES notation for 2-propan-2-yl-5-(trifluoromethyl)-3,4-dihydropyridine?
The canonical SMILES for 2-propan-2-yl-5-(trifluoromethyl)-3,4-dihydropyridine is CC(C)C1=NC=C(C(F)(F)F)CC1.
What is the InChIKey of 2-propan-2-yl-5-(trifluoromethyl)-3,4-dihydropyridine?
The InChIKey is RNFWTPWMSUAIJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3N/c1-6(2)8-4-3-7(5-13-8)9(10,11)12/h5-6H,3-4H2,1-2H3.
What are the key properties of 2-propan-2-yl-5-(trifluoromethyl)-3,4-dihydropyridine?
2-propan-2-yl-5-(trifluoromethyl)-3,4-dihydropyridine has a molecular weight of 191.20 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-5-(trifluoromethyl)-3,4-dihydropyridine is sourced from PubChem (CID 145484033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).