C28H34N6O2 — CID 123934000
3-amino-N-[4-[N-[1-(3-cyano-4-propan-2-yloxyphenyl)ethenyl]-N'-methylcarbamimidoyl]-2,3-dihydro-1H-inden-1-yl]pyrrolidine-1-carboxamide (PubChem CID 123934000) has the molecular formula C28H34N6O2 and a molecular weight of 486.62 g/mol. Its IUPAC name is 3-amino-N-[4-[N-[1-(3-cyano-4-propan-2-yloxyphenyl)ethenyl]-N'-methylcarbamimidoyl]-2,3-dihydro-1H-inden-1-yl]pyrrolidine-1-carboxamide.
| Compound Name | 3-amino-N-[4-[N-[1-(3-cyano-4-propan-2-yloxyphenyl)ethenyl]-N'-methylcarbamimidoyl]-2,3-dihydro-1H-inden-1-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 123934000 |
| Molecular Formula | C28H34N6O2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | 3-amino-N-[4-[N-[1-(3-cyano-4-propan-2-yloxyphenyl)ethenyl]-N'-methylcarbamimidoyl]-2,3-dihydro-1H-inden-1-yl]pyrrolidine-1-carboxamide |
| SMILES | C=C(N/C(=N\C)c1cccc2c1CCC2NC(=O)N1CCC(N)C1)c1ccc(OC(C)C)c(C#N)c1 |
| InChI | InChI=1S/C28H34N6O2/c1-17(2)36-26-11-8-19(14-20(26)15-29)18(3)32-27(31-4)24-7-5-6-23-22(24)9-10-25(23)33-28(35)34-13-12-21(30)16-34/h5-8,11,14,17,21,25H,3,9-10,12-13,16,30H2,1-2,4H3,(H,31,32)(H,33,35) |
| InChIKey | HZFCVPYTRWHKAV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|