C20H20N4 — CID 123328660
1-amino-N-[1-(3-cyanophenyl)ethenyl]-N'-methyl-2,3-dihydro-1H-indene-4-carboximidamide (PubChem CID 123328660) has the molecular formula C20H20N4 and a molecular weight of 316.41 g/mol. Its IUPAC name is 1-amino-N-[1-(3-cyanophenyl)ethenyl]-N'-methyl-2,3-dihydro-1H-indene-4-carboximidamide.
| Compound Name | 1-amino-N-[1-(3-cyanophenyl)ethenyl]-N'-methyl-2,3-dihydro-1H-indene-4-carboximidamide |
|---|---|
| PubChem CID | 123328660 |
| Molecular Formula | C20H20N4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 1-amino-N-[1-(3-cyanophenyl)ethenyl]-N'-methyl-2,3-dihydro-1H-indene-4-carboximidamide |
| SMILES | C=C(N/C(=N\C)c1cccc2c1CCC2N)c1cccc(C#N)c1 |
| InChI | InChI=1S/C20H20N4/c1-13(15-6-3-5-14(11-15)12-21)24-20(23-2)18-8-4-7-17-16(18)9-10-19(17)22/h3-8,11,19H,1,9-10,22H2,2H3,(H,23,24) |
| InChIKey | BOCRINFVKSQGQV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|