C14H19NO6 — CID 123934061
1-O'-(2,5-dihydroxypyrrol-1-yl) 1-O-ethyl cyclohexane-1,1-dicarboxylate (PubChem CID 123934061) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is 1-O'-(2,5-dihydroxypyrrol-1-yl) 1-O-ethyl cyclohexane-1,1-dicarboxylate.
| Compound Name | 1-O'-(2,5-dihydroxypyrrol-1-yl) 1-O-ethyl cyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 123934061 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 1-O'-(2,5-dihydroxypyrrol-1-yl) 1-O-ethyl cyclohexane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)On2c(O)ccc2O)CCCCC1 |
| InChI | InChI=1S/C14H19NO6/c1-2-20-12(18)14(8-4-3-5-9-14)13(19)21-15-10(16)6-7-11(15)17/h6-7,16-17H,2-5,8-9H2,1H3 |
| InChIKey | VBYRTLONBZXTJS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|