C24H23F2N3O3 — CID 123934573
(2,6-difluorophenyl)-[[5-[2-(methoxymethyl)-2,6-dimethylchromen-4-yl]pyrazin-2-yl]amino]methanol (PubChem CID 123934573) has the molecular formula C24H23F2N3O3 and a molecular weight of 439.46 g/mol. Its IUPAC name is (2,6-difluorophenyl)-[[5-[2-(methoxymethyl)-2,6-dimethylchromen-4-yl]pyrazin-2-yl]amino]methanol.
| Compound Name | (2,6-difluorophenyl)-[[5-[2-(methoxymethyl)-2,6-dimethylchromen-4-yl]pyrazin-2-yl]amino]methanol |
|---|---|
| PubChem CID | 123934573 |
| Molecular Formula | C24H23F2N3O3 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (2,6-difluorophenyl)-[[5-[2-(methoxymethyl)-2,6-dimethylchromen-4-yl]pyrazin-2-yl]amino]methanol |
| SMILES | COCC1(C)C=C(c2cnc(NC(O)c3c(F)cccc3F)cn2)c2cc(C)ccc2O1 |
| InChI | InChI=1S/C24H23F2N3O3/c1-14-7-8-20-15(9-14)16(10-24(2,32-20)13-31-3)19-11-28-21(12-27-19)29-23(30)22-17(25)5-4-6-18(22)26/h4-12,23,30H,13H2,1-3H3,(H,28,29) |
| InChIKey | KFZJMJHRQJKJGX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|