C32H50N2O2Si — CID 123935694
1-[10-[tert-butyl(diphenyl)silyl]oxydec-5-enyl]-3-pentylurea (PubChem CID 123935694) has the molecular formula C32H50N2O2Si and a molecular weight of 522.85 g/mol. Its IUPAC name is 1-[10-[tert-butyl(diphenyl)silyl]oxydec-5-enyl]-3-pentylurea.
| Compound Name | 1-[10-[tert-butyl(diphenyl)silyl]oxydec-5-enyl]-3-pentylurea |
|---|---|
| PubChem CID | 123935694 |
| Molecular Formula | C32H50N2O2Si |
| Molecular Weight | 522.85 g/mol |
| Exact Mass | 522.36 |
| IUPAC Name | 1-[10-[tert-butyl(diphenyl)silyl]oxydec-5-enyl]-3-pentylurea |
| SMILES | CCCCCNC(=O)NCCCCC=CCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H50N2O2Si/c1-5-6-19-26-33-31(35)34-27-20-11-9-7-8-10-12-21-28-36-37(32(2,3)4,29-22-15-13-16-23-29)30-24-17-14-18-25-30/h7-8,13-18,22-25H,5-6,9-12,19-21,26-28H2,1-4H3,(H2,33,34,35) |
| InChIKey | KRRNWINLLSMHTJ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.85 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|